Solved: Complete the table.NameMolecular FormulaStructural FormulaCondensed Structural

Solution 64P :

Step 1:

Here,we have to complete the given table :

First, let’s consider the data in the 1st row :

Given :

Name : 3-ethyl-4-methyl-1-heptene.

Now, let’s write the structural formula :

There are 7 carbon atoms in the longest chain and the number 1 before heptene indicates the triple bond is on the 1st carbon atom. As per name, there is ethyl group on the 3rd carbon atom and methyl group on the 4th carbon atom. Hence the Structural formula for the given alkene is :

Now, let’s write molecular formula :

        We can derive the molecular formula looking at the structural formula of the alkene.

The molecular formula of the alkene is  : C10H20

Now, let’s write the condensed Structural Formula :

We can derive the condensed structural formula looking at the structural formula of the alkene.

The condensed structural formula of the alkene is  :

CH2CHCH(CH2CH3)CH(CH3)CH2CH2CH3