Ch 14 - 5E

For which one of the following vessels for the reaction A + B ? C is the reaction the fastest? Assume all vessels are at the same temperature. [Section 4.1]

From the data in Figure 14.3, calculate the average rate at which A disappears over the time interval from 20 s to 40 s. Use the data in Figure 14.3 to calculate the average rate of appearance of B over the time interval from 0 s to 40 s.

Consider the following graph of the concentration of a substance over time. (a) Is X a reactant or product of the reaction? (b) Is the reaction speeding up, slowing down, or not changing its rate as time progresses? (c) Why is the average rate of the reaction different between points 1 and 2 than between points 2 and 3? [Section 14.2]

Using Figure 14.4, calculate the instantaneous rate of disappearance of C4H9Cl at t = 0s (the initial rate). Using Figure 14.4, determine the instantaneous rate of disappearance of C4H9Cl at t = 300 s.

You study the rate of a reaction, measuring both the concentration of the reactant and the concentration of the product as a function of time, and obtain the following results: Which chemical equation is consistent with these data: (a) A ? B, (b) B ? A, (c) A ? 2 B, (d) B ? 2 A? Explain your choice. [Section 14.2]

Problem 3PE Relating Rates at Which Products Appear and Reactants Disappear (a) How is the rate at which ozone disappears related to the rate at which oxygen appears in the reaction 2 O3(g)?3 O2(g)? (b) If the rate at which O2 appears,?[O2]/?t, is 6.0 × 10-5 M/s at a particular instant, at what rate is O3 disappearing at this same time, -?[O3]/?t? If the rate of decomposition of N2O5 in the reaction 2 N2O5(g)?4 NO2(g) + O2(g) at a particular instant is 4.2 × 10-7M/s, what is the rate of appearance of (a) NO2 and (b) O2 at that instant?

You perform the reaction K + L ? M, monitor the production of M over time, and then plot this graph from your data: 1. Is the reaction occurring at a constant rate from t = 0 to t = 15 min? Explain. 2. (b) Is the reaction completed at t = 15 min? Explain.

Consider a reaction A + B ? C for which rate = k[A][B]2. Each of the following boxes represents a reaction mixture in which A is shown as red spheres and B as purple ones. Rank these mixtures in order of increasing rate of reaction. Assuming that rate = k[A][B], rank the mixtures represented in this Sample Exercise in order of increasing rate.

You perform a series of experiments for the reaction A ? B + C and find that the rate law has the form rate = k [A]x. Determine the value of x in each of the following cases: (a) There is no rate change when [A]0 is tripled. (b) The rate increases by a factor of 9 when [A]0 is tripled. © When [A]0 is doubled, the rate increases by a factor of 8. [Section 14.3]

1. What is the reaction order of the reactant H2 in Equation 14.11? (b)What are the units of the rate constant for Equation 14.11?

The following diagrams represent mixtures of NO(g) and O2(g). These two substances react as follows: It has been determined experimentally that the rate is second order in NO and first order in O2. Based on this fact, which of the following mixtures will have the fastest initial rate? [Section 14.3]

The initial rate of a reaction A + B ? C was measured for several different starting concentrations of A and B, and the results are as follows: Using these data, determine (a) the rate law for the reaction, (b) the rate constant, (c) the rate of the reaction when [A] = 0.050 M and [B] = 0.100 M. The following data were measured for the reaction of nitric oxide with hydrogen: (a) Determine the rate law for this reaction. (b) Calculate the rate constant. (c) Calculate the rate when [NO] = 0.050 M and [H2] = 0.150 M.

A friend studies a first-order reaction and obtains the following three graphs for experiments done at two different temperatures. (a) Which two graphs represent experiments done at the same temperature? What accounts for the difference in these two graphs? In what way are they the same? (b) Which two graphs represent experiments done with the same starting concentration but at different temperatures? Which graph probably represents the lower temperature? How do you know? [Section 14.4]

Problem 7PE Using the Integrated First-Order Rate Law The decomposition of a certain insecticide in water at 12 °C follows first-order kinetics with a rate constant of 1.45 yr-1. A quantity of this insecticide is washed into a lake on June 1, leading to a concentration of 5.0 × 10-7 g/cm3. Assume that the temperature of the lake is constant (so that there are no effects of temperature variation on the rate). (a) What is the concentration of the insecticide on June 1 of the following year? (b) How long will it take for the insecticide concentration to decrease to 3.0 × 10-7 g/cm3? The decomposition of dimethyl ether, (CH3)2O, at 510 °C is a first-order process with a rate constant of 6.8 × 10-4 s-1: (CH3)2O(g)?CH4(g) + H2(g) + CO(g) If the initial pressure of (CH3)2O is 135 torr, what is its pressure after 1420 s?

(a) Given the following diagrams at t = 0 min and t = 30 min, what is the half-life of the reaction if it follows first-order kinetics? (b) After four half-life periods for a first-order reaction, what fraction of reactant remains? [Section 14.4]

Problem 8PE Determining Reaction Order from the Integrated Rate Law The following data were obtained for the gas-phase decomposition of nitrogen dioxide at 300 °C, NO2(g)?NO(g) + ½ O2(g). Is the reaction first or second order in NO2? The decomposition of NO2 discussed in the Sample Exercise is second order in NO2 with k = 0.543 M-1 s-1. If the initial concentration of NO2 in a closed vessel is 0.0500 M, what is the concentration of this reactant after 0.500 h?

The following diagram shows the reaction profile of a reaction. Label the components indicated by the boxes. [Section 14.5]

(a) Using Equation 14.15, calculate \(t_{1/2}\) for the decomposition of the insecticide described in Sample Exercise 14.7. (b) How long does it take for the concentration of the insecticide to reach one-quarter of the initial value?

Problem 10E You study the effect of temperature on the rate of two reactions and graph the natural logarithm of the rate constant for each reaction as a function of 1/T. How do the two graphs compare (a) if the activation energy of the second reaction is higher than the activation energy of the first reaction but the two reactions have the same frequency factor, and (b) if the frequency factor of the second reaction is higher than the frequency factor of the first reaction but the two reactions have the same activation energy? [Section 14.5]

The following graph shows two different reaction pathways for the same overall reaction at the same temperature. (a) Which pathway is slower? Why? (b) How can there be two different reaction pathways for the same reaction at the same temperature? Discuss. [Section 14.6]

Using the data in Sample Exercise 14.11, calculate the rate constant for the rearrangement of methyl isonitrile at 280°C.

Consider the diagram that follows, which represents two steps in an overall reaction. The red spheres are oxygen, the blue ones nitrogen, and the green ones fluorine. (a) Write the chemical equation for each step in the reaction. (b)Write the equation for the overall reaction. (c) Identify the intermediate in the mechanism. (d) Write the rate law for the overall reaction if the first step is the slow, rate-determining step. [Section 14.6]

Problem 12PE Determining Molecularity and Identifying Intermediates It has been proposed that the conversion of ozone into O2 proceeds by a two-step mechanism: O3(g)?O2(g) + O(g) O3(g) + O(g)?2 O2(g) (a) Describe the molecularity of each elementary reaction in this mechanism. ________________ (b) Write the equation for the overall reaction. ________________ (c) Identify the intermediate(s). For the reaction Mo(CO)6 + P(CH3)3?Mo(CO)5P(CH3)3 + CO the proposed mechanism is Mo(CO)6?Mo(CO)5 + CO Mo(CO)5 + P(CH3)3?Mo(CO)5P(CH3)3 (a) Is the proposed mechanism consistent with the equation for the overall reaction? (b) What is the molecularity of each step of the mechanism? (c) Identify the intermediate(s).

Problem 61E Temperature and Rate (Section) Based on their activation energies and energy changes and assuming that all collision factors are the same, which of the following reactions would be fastest and which would be slowest? (a) Ea = 45 kJ/mol; ?E = -25 kJ/mol ________________ (b) Ea = 35 kJ/mol; ?E = -10 kJ/mol ________________ (c) Ea = 55 kJ/mol; ?E = 10 kJ/mol

Problem 62E Temperature and Rate (Section) Which of the reactions in Exercise will be fastest in the reverse direction? Which will be slowest? Temperature and Rate (Section) (a) A certain first-order reaction has a rate constant of 2.75 × 10-2 s-1 at 20 °C. What is the value of k at 60 °C if Ea = 75.5 kJ/mol ? (b) Another first-order reaction also has a rate constant of 2.75 × 10-2 s-1 at 20 °C What is the value of k at 60 °C if Ea = 125 kJ/mol ? (c) What assumptions do you need to make in order to calculate answers for parts (a) and (b)?

Problem 63E Temperature and Rate (Section) (a) A certain first-order reaction has a rate constant of 2.75 × 10-2 s-1 at 20 °C. What is the value of k at 60 °C if Ea = 75.5 kJ/mol ? (b) Another first-order reaction also has a rate constant of 2.75 × 10-2 s-1 at 20 °C What is the value of k at 60 °C if Ea = 125 kJ/mol ? (c) What assumptions do you need to make in order to calculate answers for parts (a) and (b)?

Problem 64E Temperature and Rate (Section) Understanding the high-temperature behavior of nitrogen oxides is essential for controlling pollution generated in automobile engines. The decomposition of nitric oxide (NO) to N2 and O2 is second order with a rate constant of 0.0796 M-1s-1 at 737 °C and 0.0815 M-1s-1 at 947 °C. Calculate the activation energy for the reaction.

The rate of the reaction CH3COOC2H5(aq) + OH-(aq) ? CH3COO-(aq) + C2H5OH(aq) was measured at several temperatures, and the following data were collected: Calculate the value of Ea by constructing an appropriate graph.

The temperature dependence of the rate constant for a reaction is tabulated as follows: Calculate Ea and A.

The activation energy of a certain reaction is 65.7 kj/mol. How many times faster will the reaction occur at 50°C than at 0°C ? State the assumptions you need to make in order to perform this calculation.

The following is a quote from an article in the August 18, 1998, issue of The New York Times about the breakdown of cellulose and starch: “A drop of 18 degrees Fahrenheit [from 77°F to 59°F] lowers the reaction rate six times; a 36-degree drop [from 77°F to 41°F ] produces a fortyfold decrease in the rate.” (a) Calculate activation energies for the breakdown process based on the two estimates of the effect of temperature on rate. Are the values consistent? (b) Assuming the value of Ea calculated from the 36-degree drop and that the rate of breakdown is first order with a half-life at 25°C of 2.7 years, calculate the half-life for breakdown at a temperature of -15°C.

Problem 69E (a)What is meant by the term elementary reaction? (b)What is the difference between a unimolecular and a bimolecular elementary reaction? (c)What is a reaction mechanism?

(a) What is meant by the term molecularity? (b) Why are ter-molecular elementary reactions so rare? (c) What is an intermediate in a mechanism?

Problem 72E What is meant by the term rate-determining step?

What are the differences between an intermediate and a transition state?

Problem 73E Reaction Mechanisms (Section) What is the molecularity of each of the following elementary reactions? Write the rate law for each. (a) Cl2(g)?2 Cl(g) ________________ (b) OCl- (aq) + H2O(l)?HOCl(aq) + OH- (aq) ________________ (c) NO(g) + Cl2(g)?NOCl2(g)

What is the molecularity of each of the following elementary reactions? Write the rate law for each.

(a) Based on the following reaction profile, how many intermediates are formed in the reaction A ? D ? (b) How many transition states are there? (c) Which step is the fastest? (d) Is the reaction A ? D exothermic or endothermic?

Relating Energy Profiles to Activation Energies and Speeds of Reaction Consider a series of reactions having these energy profiles: Rank the reactions from slowest to fastest assuming that they have nearly the same value for the frequency factor A. Rank the reverse reactions from slowest to fastest.

Problem 13PE Predicting the Rate Law for an Elementary Reaction If the following reaction occurs in a single elementary reaction, predict its rate law: H2(g) + Br2(g)?2 HBr(g) Consider the following reaction: 2 NO(g) + Br2(g) ?2 NOBr(g). (a) Write the rate law for the reaction, assuming it involves a single elementary reaction. (b) Is a single-step mechanism likely for this reaction?

VISUALIZING CONCEPTS Based on the following reaction profile, how many intermediates are formed in the reaction A?C ? How many transition states are there? Which step is the fastest? Is the reaction A?C exothermic or endothermic? [Section 14.6]

VISUALIZING CONCEPTS Draw a possible transition state for the bimolecular reaction depicted here. (The blue spheres are nitrogen atoms, and the red ones are oxygen atoms.) Use dashed lines to represent the bonds that are in the process of being broken or made in the transition state. [Section 14.6]

Problem 14PE Determining the Rate Law for a Multistep Mechanism The decomposition of nitrous oxide, N2O, is believed to occur by a two-step mechanism: N2O(g)?N2(g) + O(g) (slow) N2O(g) + O(g)?N2(g) + O2(g) (fast) (a) Write the equation for the overall reaction. (b) Write the rate law for the overall reaction. Ozone reacts with nitrogen dioxide to produce dinitrogen pentoxide and oxygen: O3(g) + 2 NO2(g)?N2O5(g) + O2(g) The reaction is believed to occur in two steps: O3(g) + NO2(g) ? NO3(g) + O2(g) NO3(g) + NO2(g)?N2O5(g) The experimental rate law is rate = k[O3][NO2]. What can you say about the relative rates of the two steps of the mechanism?

Problem 15E Visualizing Concepts The following diagram represents an imaginary two-step mechanism. Let the red spheres represent element A, the green ones element B, and the blue ones element C. (a) Write the equation for the net reaction that is occurring. (b) Identify the intermediate. (c) Identify the catalyst. [Sections]

Deriving the Rate Law for a Mechanism with a Fast Initial Step Show that the following mechanism for Equation 14.24 also produces a rate law consistent with the experimentally observed one: Step 1: \(\mathrm{NO}(g)+\mathrm{NO}(g) \underset{k_{-1}}{\stackrel{k_{1}}{\rightleftarrows}} \mathrm{N}_{2} \mathrm{O}_{2}(g)\) (fast, equilibrium) Step 2: \(\mathrm{N}_{2} \mathrm{O}_{2}(g)+\mathrm{Br}_{2}(g) \stackrel{k_{2}}{\longrightarrow} 2 \mathrm{NOBr}(g)\) (slow) The first step of a mechanism involving the reaction of bromine is \(\mathrm{Br}_{2}(g) \underset{k_{-1}}{\stackrel{k_{1}}{\rightleftharpoons}} 2 \mathrm{Br}(g)\) (fast, equilibrium) What is the expression relating the concentration of \(\mathrm{Br}(g)\) to that of \(\mathrm{Br}_{2}(g)\)? Equation Transcription: NO(g)+NO(g) N2O2(g) N2O2(g)+Br2(g) 2NOBr(g) Br2(g) 2Br?(g) Br(g) Br2(g) Text Transcription: NO(g)+NO(g)?^k_1 N2O2(g)_k_-1 N_2O_2(g)+Br_2(g)?^k_2 2NOBr(g) Br2(g)?^k_1 _k_-1 2Br?(g) Br(g) Br2(g)

Problem 16E Visualizing Concepts Draw a graph showing the reaction pathway for an overall exothermic reaction with two intermediates that are produced at different rates. On your graph indicate the reactants, products, intermediates, transition states, and activation energies. [Sections]

Problem 17E Reaction Rates (Sections) (a) What is meant by the term reaction rate? (b) Name three factors that can affect the rate of a chemical reaction. (c) Is the rate of disappearance of reactants always the same as the rate of appearance of products?

(a) What are the units usually used to express the rates of reac-tions occurring in solution? (b) From your everyday experience, give two examples of the effects of temperature on the rates of reactions. (c) What is the difference between average rate and instantaneous rate?

Problem 19E Reaction Rates (Sections) Consider the following hypothetical aqueous reaction: A(aq)? B(aq). A flask is charged with 0.065 mol of A in a total volume of 100.0 mL. The following data are collected: (a) Calculate the number of moles of B at each time in the table, assuming that there are no molecules of B at time zero, and that A cleanly converts to B with no intermediates. (b) Calculate the average rate of disappearance of A for each 10-min interval in units of M/s. (c) Between t = 10 min and t = 30 min, what is the average rate of appearance of B in units of M/s? Assume that the volume of the solution is constant.

A flask is charged with 0.100 mol of A and allowed to react to form B according to the hypothetical gas-phase reaction A()B () . The following data are collected: __________________________________________________________________________ Times (s) 0 40 80 120 160 __________________________________________________________________________ Moles of A 0.100 0.67 0.045 0.030 .020 (a) Calculate the number of moles of B at each time in the table, assuming that A is cleanly converted to B with no intermediates. (b) Calculate the average rate of disappearance of A for each 40-s interval in units of mol/s . (c)What additional information would be needed to calculate the rate in units of concentration per time?

Problem 21E Reaction Rates (Sections) The isomerization of methyl isonitrile (CH3NC) to acetonitrile (CH3CN) was studied in the gas phase at 215 °C, and the following data were obtained: (a) Calculate the average rate of reaction, in M/s, for the time interval between each measurement. (b) Calculate the average rate of reaction over the entire time of the data from t= 0 to t = 15,000 s. (c) Which is greater, the average rate between t = 2000 and t = 12,000 s, or between t = 8000 and t = 15,000 s? (d) Graph (CH3NC) versus time and determine the instantaneous rates in M/s at t = 5000 s and t = 8000 s.

VISUALIZING CONCEPTS The rate of disappearance of was measured for the following reaction: The following data were collected:

Problem 23E Reaction Rates (Sections) For each of the following gas-phase reactions, indicate how the rate of disappearance of each reactant is related to the rate of appearance of each product: (a) H2O2(g)?H2(g) + O2(g) ________________ (b) 2 N2O(g)?2 N2(g) + O2(g) ________________ (c) N2(g) + 3 H2(g)?2NH3(g) ________________ (d) C2H5NH2(g)?C2H4(g) + NH3(g)

Problem 24E Reaction Rates (Sections) For each of the following gas-phase reactions, write the rate expression in terms of the appearance of each product and disappearance of each reactant: (a) 2 H2O(g)?2 H2(g) + O2(g) ________________ (b) 2 SO2(g) + O2(g)?2 SO3(g) ________________ (c) 2 NO(g) + 2 H2(g) ? N2(g) + 2 H2O(g) ________________ (d) N2(g) + 2 H2(g) ? N2H4(g)

Problem 25E Reaction Rates (Sections) (a) Consider the combust ion of H2(g): 2 H2(g) + O2(g) ? 2 H2O(g). If hydrogen is burning at the rate of 0.48 mol/s, what is the rate of consumption of oxygen? What is the rate of formation of water vapor? (b) The reaction 2 NO(g) + Cl2(g)?2 NOCl(g) is carried out in a closed vessel. If the partial pressure of NO is decreasing at the rate of 56 torr/min, what is the rate of change of the total pressure of the vessel?

(a) Consider the combustion of ethylene, \(\mathrm{C}_2 \mathrm{H}_4(\mathrm{~g})+3 \mathrm{O}_2(\mathrm{~g})\) \(\longrightarrow 2 \mathrm{CO}_2(\mathrm{~g})+2 \mathrm{H}_2 \mathrm{O}(\mathrm{g})\). If the concentration of \(\mathrm{C}_2 \mathrm{H}_4\) is decreasing at the rate of \(0.036 \mathrm{M} / \mathrm{s}\), what are the rates of change in the concentrations of \(\mathrm{CO}_2\) and \(\mathrm{H}_2 \mathrm{O}\)? (b) The rate of decrease in \(\mathrm{N}_2 \mathrm{H}_4\) partial pressure in a closed reaction vessel from the reaction \(\mathrm{N}_2 \mathrm{H}_4(\mathrm{~g})+\mathrm{H}_2(\mathrm{~g}) \longrightarrow 2 \mathrm{NH}_3(\mathrm{~g})\) is 74 torr per hour. What are the rates of change of \(\mathrm{NH}_3\) partial pressure and total pressure in the vessel?

Problem 27E Rate Laws (Section) A reaction A + B?C obeys the following rate law: Rate = k[B]2. (a) If [A] is doubled, how will the rate change? Will the rate constant change? (b) What are the reaction orders for A and B? What is the overall reaction order? (c) What are the units of the rate constant?

Problem 28E Rate Laws (Section) Consider a hypothetical reaction between A, B, and C that is first order in A, zero order in B, and second order in C. (a) Write the rate law for the reaction. (b) How does the rate change when [A] is doubled and the other reactant concentrations are held constant? (c) How does the rate change when [B] is tripled and the other reactant concentrations are held constant? (d) How does the rate change when [C] is tripled and the other reactant concentrations are held constant? (e) By what factor does the rate change when the concentrations of all three reactants are tripled? (f) By what factor does the rate change when the concentrations of all three reactants are cut in half?

Problem 29E Rate Laws (Section) The decomposition reaction of N2O5 in carbon tetrachloride is 2 N2O5?4 NO2 + O2. The rate law is first order in N2O5. At 64 °C the rate constant is 4.82 × 10-3 s-1. (a) Write the rate law for the reaction. (b) What is the rate of reaction when [N2O5] = 0.0240 M? (c) What happens to the rate when the concentration of N2O5 is doubled to 0.0480 M? (d) What happens to the rate when the concentration of N2O5 is halved to 0.0120 M?

Problem 30E Rate Laws (Section) Consider the following reaction: 2 NO(g) + 2 H2(g)?N2(g) + 2 H2O(g) (a) The rate law for this reaction is first order in H2 and second order in NO. Write the rate law. (b) If the rate constant for this reaction at 1000 K is 6.0 × 104 M-2 s-1, what is the reaction rate when [NO] = 0.035 M and [H2] = 0.015 M? (c) What is the reaction rate at 1000 K when the concentration of NO is increased to 0.10 M, while the concentration of H2 is 0.010 M? (d) What is the reaction rate at 1000 K if [NO] is decreased to 0.010 M and [H2] is increased to 0.030 M?

Consider the following reaction: \(\mathrm{CH}_3 \mathrm{Br}(a q)+\mathrm{OH}^{-}(a q) \longrightarrow \mathrm{CH}_3 \mathrm{OH}(a q)+\mathrm{Br}^{-}(a q)\) The rate law for this reaction is first order in \(\mathrm{CH}_3 \mathrm{Br}\) and first order in \(\mathrm{OH}^{-}\). When \(\left[\mathrm{CH}_3 \mathrm{Br}\right]\) is \(5.0 \times 10^{-3} \mathrm{M}\) and \(\left[\mathrm{OH}^{-}\right]\) is \(0.050 \mathrm{M}\), the reaction rate at \(298 \mathrm{~K}\) is \(0.0432 \mathrm{M} / \mathrm{s}\). (a) What is the value of the rate constant? (b) What are the units of the rate constant? (c) What would happen to the rate if the concentration of \(\mathrm{OH}^{-}\) were tripled? (d) What would happen to the rate if the concentration of both reactants were tripled?

Problem 32E Rate Laws (Section) The reaction between ethyl bromide (C2H5Br) and hydroxide ion in ethyl alcohol at 330 K, C2H5Br(alc) + OH- (alc)? C2H5OH(l) + Br- (alc), is first order each in ethyl bromide and hydroxide ion. When [C2H5Br] is 0.0477 M and [OH- ] is 0.100 M, the rate of disappearance of ethyl bromide is 1.7 × 10-7 M/s. (a) What is the value of the rate constant? (b) What are the units of the rate constant? (c) How would the rate of disappearance of ethyl bromide change if the solution were diluted by adding an equal volume of pure ethyl alcohol to the solution?

RATE LAWS (section 14.3) The iodide ion reacts with hypochlorite ion (the active ingredient in chlorine bleaches) in the following way: This rapid reaction gives the following rate data: (a) Write the rate law for this reaction. (b) Calculate the rate constant with proper units. (c) Calculate the rate when and .

RATE LAWS (section 14.3) The reaction was studied with the following results: (a) Determine the rate law for the reaction. (b) Calculate the rate constant with proper units. (c) Calculate the rate when and

RATE LAWS (section 14.3) The following data were measured for the reaction : (a) What is the rate law for the reaction? (b) What is the overall order of the reaction? (c) Calculate the rate constant with proper units? (d) What is the rate when and

RATE LAWS (section 14.3) The following data were collected for the rate of disappearance of in the reaction (a) What is the rate law for the reaction? (b) What are the units of the rate constant? (c) What is the average value of the rate constant calculated from the three data sets? (d) What is the rate of disappearance of when and What is the rate of disappearance of at the concentrations given in part (d)?

RATE LAWS (section 14.3) Consider the gas-phase reaction between nitric oxide and bromine at . The following data for the initial rate of appearance of were obtained: (a) Determine the rate law. (b) Calculate the average value of the rate constant for the appearance of from the four data sets. (c) How is the rate of appearance of NOBr related to the rate of disappearance of (d) What is the rate of disappearance of when and

Consider the reaction of peroxydisulfate ion \(\left(\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}\right)\) with iodide ion \(\left(\mathrm{I}^{-}\right)\) in aqueous solution: \(\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}(a q)+3 \mathrm{I}^{-}(a q) \longrightarrow 2 \mathrm{SO}_{4}{ }^{2-}(a q)+\mathrm{I}_{3}{ }^{-}(a q)\) At a particular temperature the initial rate of disappearance of \(\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}\) varies with reactant concentrations in the following manner: (a) Determine the rate law for the reaction and state the units of the rate constant. (b) What is the average value of the rate constant for the disappearance of \(\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}\) based on the four sets of data? (c) How is the rate of disappearance of \(\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}\) related to the rate of disappearance of \(\mathrm{I}^{-}\)? (d) What is the rate of disappearance of \(\mathrm{I}^{-}\) when \(\left[\mathrm{S}_{2} \mathrm{O}_{8}{ }^{2-}\right]=0.025 \mathrm{M}\) and \(\left[\mathrm{I}^{-}\right]=0.050 \mathrm{M}\)?

Problem 39E Change of Concentration with Time (Section) (a) Define the following symbols that are encountered in rate equations for the generic reaction AS B: [A]0, t½ [A]t, k. (b) What quantity, when graphed versus time, will yield a straight line for a first-order reaction? (c) How can you calculate the rate constant for a first-order reaction from the graph you made in part (b)?

Problem 40E Change of Concentration with Time (Section) (a) For a generic second-order reaction A?B, what quantity, when graphed versus time, will yield a straight line? (b) What is the slope of the straight line from part (a)? (c) How do the half-lives of first-order and second-order reactions differ?

CHANGE OF CONCENTRATION WITH TIME (section 14.4) For the generic reaction A ? B that is zero order in A, what would you graph in order to obtain the rate constant?

Problem 43E Change of Concentration with Time (Section) (a) The gas-phase decomposition of SO2Cl2, SO2Cl2(g)? SO2(g) + Cl2(g), is first order in SO2Cl2. At 600 K the halflife for this process is 2.3 × 105 s. What is the rate constant at this temperature? (b) At 320 °C the rate constant is 2.2 × 10-5 s-1. What is the half-life at this temperature?

CHANGE OF CONCENTRATION WITH TIME (section 14.4) Sketch a graph for the generic first-order reaction A ? B that has concentration of A on the vertical axis and time on the horizontal axis. (a) Is this graph linear? Explain. (b) Indicate on your graph the half-life for the reaction.

Problem 44E Change of Concentration with Time (Section) Molecular iodine, I2(g), dissociates into iodine atoms at 625 K with a first-order rate constant of 0.271 s-1. (a) What is the half-life for this reaction? (b) If you start with 0.050 M I2 at this temperature, how much will remain after 5.12 s assuming that the iodine atoms do not recombine to form I2?

Problem 45E Change of Concentration with Time (Section) As described in Exercise, the decomposition of sulfuryl chloride (SO2Cl2) is a first-order process. The rate constant for the decomposition at 660 K is 4.5 × 10-2 s-1. (a) If we begin with an initial SO2Cl2 pressure of 450 torr, what is the partial pressure of this substance after 60 s? (b) At what time will the partial pressure of SO2Cl2 decline to one-tenth its initial value? Exercise Change of Concentration with Time (Section) (a) The gas-phase decomposition of SO2Cl2, SO2Cl2(g)? SO2(g) + Cl2(g), is first order in SO2Cl2. At 600 K the halflife for this process is 2.3 × 105 s. What is the rate constant at this temperature? (b) At 320 °C the rate constant is 2.2 × 10-5 s-1. What is the half-life at this temperature?

Problem 46E Change of Concentration with Time (Section) The first-order rate constant for the decomposition of N2O5, 2 N2O5(g)?4 NO2(g) + O2(g), at 70 °C is 6.82 × 10-3 s-1. Suppose we start with 0.0250 mol of N2O5(g) in a volume of 2.0 L. (a) How many moles of N2O5 will remain after 5.0 min? (b) How many minutes will it take for the quantity of N2O5 to drop to 0.010 mol? (c) What is the half-life of N2O5 at 70 °C ?

CHANGE OF CONCENTRATION WITH TIME (section 14.4) The reaction is first order in . Using the following kinetic data, determine the magnitude and units of the first-order rate constant:

CHANGE OF CONCENTRATION WITH TIME (section 14.4) From the following data for the first-order gas-phase isomerization of at , calculate the first-order rate constant and half-life for the reaction:

CHANGE OF CONCENTRATION WITH TIME (section 14.4) Consider the data presented in Exercise 14.19. (a) By using appropriate graphs, determine whether the reaction is first order or second order. (b)What is the rate constant for the reaction? (c)What is the half-life for the reaction?

Problem 50E Change of Concentration with Time (Section) Consider the data presented in Exercise. (a) Determine whether the reaction is first order or second order. (b) What is the rate constant? (c) What is the half-life? Reaction Rates (Sections) A flask is charged with 0.100 mol of A and allowed to react to form B according to the hypothetical gas-phase reaction A(g)?B(g). The following data are collected: (a) Calculate the number of moles of B at each time in the table, assuming that A is cleanly converted to B with no intermediates. (b) Calculate the average rate of disappearance of A for each 40-s interval in units of mol/s. (c) Which of the following would be needed to calculate the rate in units of concentration per time: (i) the pressure of the gas at each time, (ii) the volume of the reaction flask, (iii) the temperature, or (iv) the molecular weight of A?

CHANGE OF CONCENTRATION WITH TIME (section 14.4) The gas-phase decomposition of , is studied at , giving the following data: (a) Is the reaction first order or second order with respect to the concentration of What is the rate constant? (c) If you used the method of initial rates to obtain the order for , predict what reaction rates you would measure in the beginning of the reaction for initial concentrations of , and

CHANGE OF CONCENTRATION WITH TIME (section 14.4) Sucrose , commonly known as table sugar, reacts in dilute acid solutions to form two simpler sugars, glucose and fructose, both of which have the formula At and in , the following data were obtained for the disappearance of sucrose: (a) Is the reaction first order or second order with respect to What is the rate constant? (c) Using this rate constant, calculate the concentration of sucrose at , and if the initial sucrose concentration was and the reaction was zero order in sucrose.

(a) What factors determine whether a collision between two molecules will lead to a chemical reaction? (b) According to the collision model, why does temperature affect the value of the rate constant? (c) Does the rate constant for a reaction generally increase or decrease with an increase in reaction temperature?

Problem 54E Temperature and Rate (Section) (a) In which of the following reactions would you expect the orientation factor to be least important in leading to reaction: NO + O?NO2 or H + Cl?HCl? (b) How does the kinetic-molecular theory help us understand the temperature dependence of chemical reactions?

Problem 55E Temperature and Rate (Section) Calculate the fraction of atoms in a sample of argon gas at 400 K that has an energy of 10.0 kJ or greater.

TEMPERATURE AND RATE (section 14.5) (a) The activation energy for the isomerization of methyl isonitrile (Figure 14.7) is 160 kJ/mol . Calculate the fraction of methyl isonitrile molecules that has an energy of 160.0 kJ or greater at 500 K. (b) Calculate this fraction for a temperature of 520 K. What is the ratio of the fraction at 520 K to that at 500 K?

The gas-phase reaction \(Cl(g) + HBr(g) \longrightarrow HCl(g) + Br(g)\) has an overall energy change of -66 kJ. The activation energy for the reaction is 7 kJ. (a) Sketch the energy profile for the reaction, and label \(E_a\) and \(\Delta E\). (b) What is the activation energy for the reverse reaction?

For the elementary process \(N_2 O_5(g) \longrightarrow NO_2(g) + NO_3(g)\) the activation energy (\(E_a\)) and overall \(\Delta E\) are 154 kJ/mol and 136 kJ/mol, respectively. (a) Sketch the energy profile for this reaction, and label \(E_a\) and \(\Delta E\). (b) What is the activation energy for the reverse reaction?

Problem 59E Temperature and Rate (Section) Indicate whether each statement is true or false. (a) If you compare two reactions with similar collision factors, the one with the larger activation energy will be faster. ________________ (b) A reaction that has a small rate constant must have a small frequency factor. ________________ (c) Increasing the reaction temperature increases the fraction of successful collisions between reactants.

Problem 60E Temperature and Rate (Section) Indicate whether each statement is true or false. (a) If you measure the rate constant for a reaction at different temperatures, you can calculate the overall enthalpy change for the reaction. ________________ (b) Exothermic reactions are faster than endothermic reactions. ________________ (c) If you double the temperature for a reaction, you cut the activation energy in half.

Problem 77E Reaction Mechanisms (Section) The following mechanism has been proposed for the gasphase reaction of H2 with ICl: H2(g) + ICl(g)?HI(g) + HCl(g) HI(g) + ICl(g)?I2(g) + HCl(g) (a) Write the balanced equation for the overall reaction. (b) Identify any intermediates in the mechanism. (c) If the first step is slow and the second one is fast, which rate law do you expect to be observed for the overall reaction?

REACTION MECHANISMS (section 14.6) Consider the following energy profile. (a) How many elementary reactions are in the reaction mechanism? (b) How many intermediates are formed in the reaction? (c) Which step is rate limiting? (d) Is the overall reaction exothermic or endothermic?

Problem 78E Reaction Mechanisms (Section) The decomposition of hydrogen peroxide is catalyzed by iodide ion. The catalyzed reaction is thought to proceed by a two-step mechanism: H2O2(aq) + I - (aq)?H2O(l) + IO- (aq) (slow) IO- (aq) + H2O2(aq)?H2O(l) + O2(g) + I - (aq) (fast) (a) Write the chemical equation for the overall process. (b) Identify the intermediate, if any, in the mechanism. (c) Assuming that the first step of the mechanism is rate determining, predict the rate law for the overall process.

REACTION MECHANISMS (section 14.6) The reaction was performed and the following data obtained: Is the following mechanism consistent with the data? Explain.

Problem 80E Reaction Mechanisms (Section) You have studied the gas-phase oxidation of HBr by O2: 4 HBr(g) + O2(g)?2 H2O(g) + 2 Br2(g) You find the reaction to be first order with respect to HBr and first order with respect to O2. You propose the following mechanism: HBr(g) + O2(g)? HOOBr(g) HOOBr(g) + HBr(g)?2 HOBr(g) HOBr(g) + HBr(g)? H2O(g) + Br2(g) (a) Confirm that the elementary reactions add to give the overall reaction. (b) Based on the experimentally determined rate law, which step is rate determining? (c) What are the intermediates in this mechanism? (d) If you are unable to detect HOBr or HOOBr among the products, does this disprove your mechanism?

Problem 81E Catalysis (Section) (a) What is a catalyst? (b) What is the difference between a homogeneous and a heterogeneous catalyst? (c) Do catalysts affect the overall enthalpy change for a reaction, the activation energy, or both?

Problem 82E Catalysis (Section) (a) Most commercial heterogeneous catalysts are extremely finely divided solid materials. Why is particle size important? (b) What role does adsorption play in the action of a heterogeneous catalyst?

CATALYSIS (section 14.7) Platinum nanoparticles of diameter are important catalysts in carbon monoxide oxidation to carbon dioxide. Platinum crystallizes in a face-centered cubic arrangement with an edge length of . (a) Estimate how many platinum atoms would fit into a sphere; the volume of a sphere is . Recall that and . (b) Estimate how many platinum atoms are on the surface of a sphere, using the surface area of a sphere and assuming that the "footprint" of one atom can be estimated from its atomic diameter of . (c) Using your results from (a) and (b), calculate the percentage of atoms that are on the surface of a nanoparticle. (d) Repeat these calculations for a 5.0-nm platinum nanoparticle. (e) Which size of nanoparticle would you expect to be more catalytically active and why?

Problem 84E Catalysis (Section) In solution, chemical species as simple as H+ and OH- can serve as catalysts for reactions. Imagine you could measure the [H+] of a solution containing an acid-catalyzed reaction as it occurs. Assume the reactants and products themselves are neither acids nor bases. Sketch the [H+] concentration profile you would measure as a function of time for the reaction, assuming t = 0 is when you add a drop of acid to the reaction.

Problem 85E Catalysis (Section) The oxidation of SO2 to SO3 is accelerated by NO2. The reaction proceeds according to: NO2(g) + SO2(g)? NO(g) + SO3(g) 2 NO(g) + O2(g)?2 NO2(g) (a) Show that, with appropriate coefficients, the two reactions can be summed to give the overall oxidation of SO2 by O2 to give SO3. (b) Do we consider NO2 a catalyst or an intermediate in this reaction? (c) Is this an example of homogeneous catalysis or heterogeneous catalysis?

Problem 86E Catalysis (Section) The addition of NO accelerates the decomposition of N2O, possibly by the following mechanism: NO(g) + N2O(g)?N2(g) + NO2(g) 2 NO2(g)?2 NO(g) + O2(g) (a) What is the chemical equation for the overall reaction? Show how the two steps can be added to give the overall equation. (b) Is NO serving as a catalyst or an intermediate in this reaction? (c) If experiments show that during the decomposition of N2O, NO2 does not accumulate in measurable quantities, does this rule out the proposed mechanism?

Problem 87E Catalysis (Section) Many metallic catalysts, particularly the precious-metal ones, are often deposited as very thin films on a substance of high surface area per unit mass, such as alumina (Al2O3) or silica (SiO2). (a) Why is this an effective way of utilizing the catalyst material compared to having powdered metals? (b) How does the surface area affect the rate of reaction?

Problem 88E Catalysis (Section) (a) If you were going to build a system to check the effectiveness of automobile catalytic converters on cars, what substances would you want to look for in the car exhaust? (b) Automobile catalytic converters have to work at high temperatures, as hot exhaust gases stream through them. In what ways could this be an advantage? In what ways a disadvantage? (c) Why is the rate of flow of exhaust gases over a catalytic converter important?

CATALYSIS (section 14.7) When reacts with ethylene in the presence of a finely divided catalyst, ethane with two deuteriums, , is formed. (Deuterium, , is an isotope of hydrogen of mass 2 ). Very little ethane forms in which two deuteriums are bound to one carbon (for example, ). Use the sequence of steps involved in the reaction (Figure ) to explain why this is so.

CATALYSIS (section 14.7) Heterogeneous catalysts that perform hydrogenation reactions, as illustrated in Figure , are subject to "poisoning" which shuts down their catalytic ability. Compounds of sulfur are often poisons. Suggest a mechanism by which such compounds might act as poisons.

CATALYSIS (section 14.7) (a) Explain the importance of enzymes in biological systems. (b) What chemical transformations are catalyzed ( ) by the enzyme catalase, (ii) by nitrogenase? (c) Many enzymes follow this generic reaction mechanism, where is enzyme, is substrate, is the enzyme-substrate complex (where the substrate is bound to the enzyme's active site), and is the product: 1 2 What assumptions are made in this model with regard to the rate of the bound substrate being chemically transformed into bound product in the active site?

Problem 92E There are literally thousands of enzymes at work in complex living systems such as human beings. What properties of enzymes give rise to their ability to distinguish one substrate from another?

Problem 93E Catalysis (Section) The enzyme carbonic anhydrase catalyzes the reaction CO2(g) + H2O(l)?HCO3 - (aq) + H+(aq). In water, without the enzyme, the reaction proceeds with a rate constant of 0.039 s-1 at 25 °C. In the presence of the enzyme in water, the reaction proceeds with a rate constant of 1.0 × 106 s-1 at 25 °C. Assuming the collision factor is the same for both situations, calculate the difference in activation energies for the uncatalyzed versus enzyme-catalyzed reaction.

The enzyme urease catalyzes the reaction of urea, \(\left(\mathrm{NH}_2 \mathrm{CONH}_2\right)\), with water to produce carbon dioxide and ammonia. In water, without the enzyme, the reaction proceeds with a first-order rate constant of \(4.15 \times 10^{-5} \mathrm{~s}^{-1}\) at \(100^{\circ} \mathrm{C}\). In the presence of the enzyme in water, the reaction proceeds with a rate constant of \(3.4 \times 10^4 \mathrm{~s}^{-1}\) at \(21^{\circ} \mathrm{C}\). (a) Write out the balanced equation for the reaction catalyzed by urease. (b) Assuming the collision factor is the same for both situations, estimate the difference in activation energies for the uncatalyzed versus enzyme-catalyzed reaction.

Problem 95E Catalysis (Section) The activation energy of an uncatalyzed reaction is 95 kJ/mol. The addition of a catalyst lowers the activation energy to 55 kJ/mol. Assuming that the collision factor remains the same, by what factor will the catalyst increase the rate of the reaction at (a) 25 °C, (b) 125 °C?

Problem 96E Catalysis (Section) Suppose that a certain biologically important reaction is quite slow at physiological temperature (37 °C) in the absence of a catalyst. Assuming that the collision factor remains the same, by how much must an enzyme lower the activation energy of the reaction to achieve a 1 × 105-fold increase in the reaction rate?

Explain why rate laws generally cannot be written from balanced equations. Under what circumstance is the rate law related directly to the balanced equation for a reaction?

Problem 98AE Hydrogen sulfide (H2S) is a common and troublesome pollutant in industrial wastewaters. One way to remove H2S is to treat the water with chlorine, in which case the following reaction occurs: H2S(aq) + Cl2(aq)?S(s) + 2 H+(aq) + 2 Cl- (aq) The rate of this reaction is first order in each reactant. The rate constant for the disappearance of H2S at 28 °C is 3.5 × 10-2 M-1 s-1. If at a given time the concentration of H2S is 2.0 × 10- 4M and that of Cl2 s 0.025 M, what is the rate of formation of Cl- ?

Problem 99AE The reaction 2 NO(g) + O2(g)?2 NO2(g) is second order in NO and first order in O2. When [NO] = 0.040 M, and [O2] = 0.035 M, the observed rate of disappearance of NO is 9.3 × 10-5M/s. (a) What is the rate of disappearance of O2 at this moment? (b) What is the value of the rate constant? (c) What are the units of the rate constant? (d) What would happen to the rate if the concentration of NO were increased by a factor of 1.8?

Consider the following reaction between mercury(II) chloride and oxalate ion: \(2 \mathrm{HgCl}_2(a q)+\mathrm{C}_2 \mathrm{O}_4{ }^{2-}(a q) \longrightarrow\) \(2 \mathrm{Cl}^{-}(a q)+2 \mathrm{CO}_2(g)+\mathrm{Hg}_2 \mathrm{Cl}_2(s)\) The initial rate of this reaction was determined for several concentrations of \(\mathrm{HgCl}_2\) and \(\mathrm{C}_2 \mathrm{O}_4{ }^{2-}\), and the following rate data were obtained for the rate of disappearance of \(\mathrm{C}_2 \mathrm{O}_4{ }^{2-}\): (a) What is the rate law for this reaction? (b) What is the value of the rate constant with proper units? (c) What is the reaction rate when the initial concentration of \(\mathrm{Hg}_2 \mathrm{Cl}_2\) is 0.100 M and that of \((\mathrm{C}_2 \mathrm{O}_4{ }^{2-})\) is 0.25 M. if the temperature is the same as that used to obtain the data shown?

The reaction \(2 \mathrm{NO}_2 \longrightarrow 2 \mathrm{NO}+\mathrm{O}_2\) has the rate constant \(k=0.63 M^{-1} \mathrm{~s}^{-1}\). Based on the units for k, is the reaction first or second order in \(\mathrm{NO}_2\)? If the initial concentration of \(\mathrm{NO}_2\) is 0.100 M, how would you determine how long it would take for the concentration to decrease to 0.025 M?

When chemists are performing kinetics experiments, the general rule of thumb is to allow the reaction to proceed for 4 half-lives. (a) Explain how you would be able to tell that the reaction has proceeded for 4 half-lives. (b) Let us suppose a reaction \(A \longrightarrow B\) takes 6 days to proceed for 4 half-lives and is first order in A. However, when your lab partner performs this reaction for the first time, he does not realize how long it takes, and he stops taking kinetic data, monitoring the loss of A, after only 2 hours. Your lab partner concludes the reaction is zero order in A based on the data. Sketch a graph of [A] versus time to convince your lab partner the two of you need to be in the lab for a few days to obtain the proper rate law for the reaction.

Problem 104AE (a) The reaction H2O2(aq)?H2O(l) + ½O2(g) is first order. Near room temperature, the rate constant equals 7.0 ×10-4 s-1. Calculate the half-life at this temperature. (b) At 415 °C, (CH2)2O decomposes in the gas phase, (CH2)2O(g)?CH4(g) + CO(g). If the reaction is first order with a half-life of 56.3 min at this temperature, calculate the rate constant in s-1.

Americium-241 is used in smoke detectors. It has a first–order rate constant for radioactive decay of \(k = 1.6 × 10^{-3}\) \(yr^{-1}\). By contrast, iodine-125, which is used to test for thyroid functioning, has a rate constant for radioactive decay of k = 0.011 \(day^{-1}\). (a) What are the half-lives of these two isotopes? (b) Which one decays at a faster rate? (c) How much of a 1.00-mg sample of each isotope remains after 3 half-lives? (d) How much of a 1.00-mg sample of each isotope remains after 4 days?

Problem 107AE The rate of a first-order reaction is followed by spectroscopy, monitoring the absorbance of a colored reactant at 520 nm. The reaction occurs in a 1.00-cm sample cell, and the only colored species in the reaction has an extinction coefficient of 5.60 × 103 M-1 cm-1 at 520 nm. (a) Calculate the initial concentration of the colored reactant if the absorbance is 0.605 at the beginning of the reaction. (b) The absorbance falls to 0.250 at 30.0 min. Calculate the rate constant in units of s- 1. (c) Calculate the half-life of the reaction. (d) How long does it take for the absorbance to fall to 0.100?

A colored dye compound decomposes to give a colorless product. The original dye absorbs at and has an extinction coefficient of at that wavelength. You perform the decomposition reaction in a cuvette in a spectrometer and obtain the following data: From these data, determine the rate law for the reaction "dye product" and determine the rate constant.

Cyclopentadiene \(\left(\mathrm{C}_{5} \mathrm{H}_{6}\right)\) reacts with itself to form dicyclopentadiene \(\left(\mathrm{C}_{10} \mathrm{H}_{12}\right)\). A 0.0400 M solution of \(\mathrm{C}_{5} \mathrm{H}_{6}\) was monitored as a function of time as the reaction \(2 \ \mathrm{C}_{5} \mathrm{H}_{6} \longrightarrow \mathrm{C}_{10} \mathrm{H}_{12}\) proceeded. The following data were collected: Plot \(\left[\mathrm{C}_{5} \mathrm{H}_{6}\right]\) versus time, \(\ln \left[\mathrm{C}_{5} \mathrm{H}_{6}\right]\) versus time, and \(1 /\left[\mathrm{C}_{5} \mathrm{H}_{6}\right]\) versus time. What is the order of the reaction? What is the value of the rate constant? Equation Transcription: (C5H6) (C10H12) C5H6 2 C5H6?C10H12 [C5H6] ln [C5H6] 1/[C5H6] Text Transcription: (C_5H_6) (C_10H_12) C_5H_6 2 C_5H_6 right arrow C_10H_12 [C_5H_6] ln ?[C_5H_6] 1/[C_5H_6]

(a) Two reactions have identical values for . Does this ensure that they will have the same rate constant if run at the same temperature? Explain. (b) Two similar reactions have the same rate constant at , but at one of the reactions has a larger rate constant than the other. Account for| these observations.

The first-order rate constant for reaction of a particular organic compound with water varies with temperature as follows: From these data, calculate the activation energy in units of kJ/mol.

Problem 112AE The following mechanism has been proposed for the reaction of NO with H2 to form N2O and H2O: NO(g) + NO(g)?N2O2(g) N2O2(g) + H2(g)?N2O(g) + H2O(g) (a) Show that the elementary reactions of the proposed mechanism add to provide a balanced equation for the reaction. (b) Write a rate law for each elementary reaction in the mechanism. (c) Identify any intermediates in the mechanism. (d) The observed rate law is rate = k[NO]2[H2]. If the proposed mechanism is correct, what can we conclude about the relative speeds of the first and second reactions?

Ozone in the upper atmosphere can be destroyed by the following two-step mechanism: (a) What is the overall equation for this process? (b) What is the catalyst in the reaction? How do you know? (c) What is the intermediate in the reaction? How do you distinguish it from the catalyst?

The following mechanism has been proposed for the gas-phase reaction of chloroform \((CHCl_3)\) and chlorine: (a) What is the overall reaction? (b) What are the intermediates in the mechanism? (c) What is the molecularity of each of the elementary reactions? (d) What is the rate-determining step? (e) What is the rate law predicted by this mechanism? (Hint: The overall reaction order is not an integer.)

In a hydrocarbon solution, the gold compound \((CH_3)_3AuPH_3\) decomposes into ethane (\(C_2H_6\)) and a different gold compound, \((CH_3)_3AuPH_3\). The following mechanism has been proposed for the decomposition of \((CH_3)_3AuPH_3\): (a) What is the overall reaction? (b) What are the intermediates in the mechanism? (c) What is the molecularity of each of the elementary steps? (d) What is the rate-determining step? (e) What is the rate law predicted by this mechanism? (f) What would be the effect on the reaction rate of adding \(PH_3\) to the solution of \((CH_3)_3AuPH_3\)?

One of the many remarkable enzymes in the human body is carbonic anhydrase, which catalyzes the interconversion of carbon dioxide and water with bicarbonate ion and protons. If it were not for this enzyme, the body could not rid itself rapidly enough of the \(CO_2\) accumulated by cell metabolism. The enzyme catalyzes the dehydration (release to air) of up to \(10^7\) \(CO_2\) molecules per second.Which components of this description correspond to the terms enzyme, substrate, and turnover number?

Enzymes are often described as following the two-step mechanism: \(\begin{array}{ll} \mathrm{E}+\mathrm{S} \rightleftharpoons \mathrm{ES} & \text { (fast) } \\ \mathrm{ES} \longrightarrow \mathrm{E}+\mathrm{P} & \text { (slow) } \end{array}\) where \(\mathrm{E}=\) enzyme, \(\mathrm{S}=\) substrate, \(\mathrm{ES}=\) enzyme-substrate complex, and \(\mathrm{P}=\) product. (a) If an enzyme follows this mechanism, what rate law is expected for the reaction? (b) Molecules that can bind to the active site of an enzyme but are not converted into product are called enzyme inhibitors. Write an additional elementary step to add into the preceding mechanism to account for the reaction of E with I, an inhibitor.

Problem 119IE Dinitrogen pentoxide (N2O5) decomposes in chloroform as a solvent to yield NO2 and O2. The decomposition is first order with a rate constant at 45 °C of 1.0 × 10-5 s-1. Calculate the partial pressure of O2 produced from 1.00 L of 0.600 M N2O5 solution at 45 °C over a period of 20.0 h if the gas is collected in a 10.0-L container. (Assume that the products do not dissolve in chloroform.)

The reaction between ethyl iodide and hydroxide ion in ethanol \(\left(\mathrm{C}_2 \mathrm{H}_5 \mathrm{OH}\right)\) solution, \(\mathrm{C}_2 \mathrm{H}_5 \mathrm{I}(\) alc \()+\mathrm{OH}^{-}(\)alc \() \longrightarrow\) \(\mathrm{C}_2 \mathrm{H}_5 \mathrm{OH}(l)+\mathrm{I}^{-}(\mathrm{alc})\), has an activation energy of \(86.8 \mathrm{~kJ} / \mathrm{mol}\) and a frequency factor of \(2.10 \times 10^{11} \mathrm{M}^{-1} \mathrm{~s}^{-1}\). (a) Predict the rate constant for the reaction at \(35^{\circ} \mathrm{C}\). (b) A solution of \(\mathrm{KOH}\) in ethanol is made up by dissolving \(0.335 \mathrm{~g}\) \(\mathrm{KOH}\) in ethanol to form \(250.0 \mathrm{~mL}\) of solution. Similarly, \(1.453 \mathrm{~g}\) of \(\mathrm{C}_2 \mathrm{H}_5 \mathrm{I}\) is dissolved in ethanol to form \(250.0 \mathrm{~mL}\) of solution. Equal volumes of the two solutions are mixed. Assuming the reaction is first order in each reactant, what is the initial rate at \(35^{\circ} \mathrm{C}\)? (c) Which reagent in the reaction is limiting, assuming the reaction proceeds to completion? (d) Assuming the frequency factor and activation energy do not change as a function of temperature, calculate the rate constant for the reaction at \(50^{\circ} \mathrm{C}\).

You obtain kinetic data for a reaction at a set of different temperatures.You plot versus 1/and obtain the following graph: Suggest a molecular-level interpretation of these unusual data.

Problem 122IE Integrative Exercises The gas-phase reaction of NO with F2 to form NOF and F has an activation energy of Ea = 6.3 kJ/mol. and a frequency factor of A = 6.0 × 108 M-1 s-1. The reaction is believed to be bimolecular: NO(g) + F2(g) ? NOF(g) + F(g) (a) Calculate the rate constant at 100 °C. (b) Draw the Lewis structures for the NO and the NOF molecules, given that the chemical formula for NOF is misleading because the nitrogen atom is actually the central atom in the molecule. (c) Predict the shape for the NOF molecule. (d) Draw a possible transition state for the formation of NOF, using dashed lines to indicate the weak bonds that are beginning to form. (e) Suggest a reason for the low activation energy for the reaction.

Problem 123IE The mechanism for the oxidation of HBr by O2 to form 2 H2O and Br2 is shown in Exercise. (a) Calculate the overall standard enthalpy change for the reaction process. (b) HBr does not react with O2 at a measurable rate at room temperature under ordinary conditions. What can you infer from this about the magnitude of the activation energy for the rate-determining step? (c) Draw a plausible Lewis structure for the intermediate HOOBr. To what familiar compound of hydrogen and oxygen does it appear similar? Reaction Mechanisms (Section) You have studied the gas-phase oxidation of HBr by O2: 4 HBr(g) + O2(g)?2 H2O(g) + 2 Br2(g) You find the reaction to be first order with respect to HBr and first order with respect to O2. You propose the following mechanism: HBr(g) + O2(g)? HOOBr(g) HOOBr(g) + HBr(g)?2 HOBr(g) HOBr(g) + HBr(g)? H2O(g) + Br2(g) (a) Confirm that the elementary reactions add to give the overall reaction. (b) Based on the experimentally determined rate law, which step is rate determining? (c) What are the intermediates in this mechanism? (d) If you are unable to detect HOBr or HOOBr among the products, does this disprove your mechanism?

The rates of many atmospheric reactions are accelerated by the absorption of light by one of the reactants. For example, consider the reaction between methane and chlorine to produce methyl chloride and hydrogen chloride: Reaction 1: \(\mathrm{CH}_{4}(g)+\mathrm{Cl}_{2}(g) \longrightarrow \mathrm{CH}_{3} \mathrm{Cl}(g)+\mathrm{HCl}(g)\) This reaction is very slow in the absence of light. However, \(\mathrm{Cl}_{2}(g)\) can absorb light to form \(\mathrm{Cl}\) atoms: Reaction 2: \(\mathrm{Cl}_{2}(g)+h v \longrightarrow 2 \mathrm{Cl}(g)\) Once the \(\mathrm{Cl}\) atoms are generated, they can catalyze the reaction of \(\mathrm{CH}_{4}\) and \(\mathrm{Cl}_{2}\), according to the following proposed mechanism: Reaction 3: \(\mathrm{CH}_{4}(g)+\mathrm{Cl}(g) \longrightarrow \mathrm{CH}_{3}(g)+\mathrm{HCl}(g)\) Reaction 4: \(\mathrm{CH}_{3}(g)+\mathrm{Cl}_{2}(g) \longrightarrow \mathrm{CH}_{3} \mathrm{Cl}(g)+\mathrm{Cl}(g)\) The enthalpy changes and activation energies for these two reactions are tabulated as follows: (a) By using the bond enthalpy for \(\mathrm{Cl}_{2}\) (Table 8.4), determine the longest wavelength of light that is energetic enough to cause reaction 2 to occur. In which portion of the electromagnetic spectrum is this light found? (b) By using the data tabulated here, sketch a quantitative energy profile for the catalyzed reaction represented by reactions 3 and 4. (c) By using bond enthalpies, estimate where the reactants, \(\mathrm{CH}_{4}(g)+\mathrm{Cl}_{2}(g)\), should be placed on your diagram in part (b). Use this result to estimate the value of \(E_{a}\) for the reaction \(\mathrm{CH}_{4}(g)+\mathrm{Cl}_{2}(g) \longrightarrow \mathrm{CH}_{3}(g)+\mathrm{HCl}(g)+\mathrm{Cl}(g)\). (d) The species \(\mathrm{Cl}(g)\) and \(\mathrm{CH}_{3}(g)\) in reactions 3 and 4 are radicals, that is, atoms or molecules with unpaired electrons. Draw a Lewis structure of \(\mathrm{CH}_{3}\), and verify that it is a radical. (e) The sequence of reactions 3 and 4 comprises a radical chain mechanism.Why do you think this is called a “chain reaction”? Propose a reaction that will terminate the chain reaction. Equation Transcription: CH4(g)+Cl2(g)CH3Cl(g)+HCl?(g) Cl2(g) Cl Cl2(g)+hv2Cl(g) CH4 Cl2 CH4(g)+Cl(g)CH3(g)+HCl(g) CH3(g)+Cl2(g)CH3Cl(g)+Cl(g) CH4(g)+Cl2(g) Ea CH4(g)+Cl2(g)CH3(g)+ HCl(g)+Cl(g) Cl(g) CH3(g) CH3 Text Transcription: CH_4(g)+Cl_2(g) right arrow CH_3Cl(g)+HCl?(g) Cl_2(g) Cl Cl_2(g)+hv right arrow 2Cl(g) CH_4 Cl_2 CH_4(g)+Cl(g) right arrow CH_3(g)+HCl(g) CH_3(g)+Cl_2(g) right arrow CH_3Cl(g)+Cl(g) CH_4(g)+Cl_2(g) E_a CH_4(g)+Cl_2(g) right arrow CH_3(g)+ HCl(g)+Cl(g) Cl(g) CH_3(g) CH_3

Problem 125IE Many primary amines, RNH2, where R is a carbon-containing fragment such as CH3, CH3CH2, and so on, undergo reactions where the transition state is tetrahedral. (a) Draw a hybrid orbital picture to visualize the bonding at the nitrogen in a primary amine (just use a C atom for “R”). (b) What kind of reactant with a primary amine can produce a tetrahedral intermediate?

The waste stream from automobile exhaust includes species such as and . Catalysts that convert these species to are desirable to reduce air pollution. (a) Draw the Lewis dot and VSEPR structures of , and . (b) Using a resource such as Table , look up the energies of the bonds in these molecules. In what region of the electromagnetic spectrum are these energies? (c) Design a spectroscopic experiment to monitor the conversion of into , describing what wavelengths of light need to be monitored as a function of time.